C25H24BrF3N6O — CID 167962692
1-[(3S,4S)-3-[[4-(4-aminophenyl)triazol-1-yl]methyl]-4-(trifluoromethyl)pyrrolidin-1-yl]-2-(5-bromo-2-methyl-1H-indol-3-yl)ethanone (PubChem CID 167962692) has the molecular formula C25H24BrF3N6O and a molecular weight of 561.41 g/mol. Its IUPAC name is 1-[(3S,4S)-3-[[4-(4-aminophenyl)triazol-1-yl]methyl]-4-(trifluoromethyl)pyrrolidin-1-yl]-2-(5-bromo-2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-[(3S,4S)-3-[[4-(4-aminophenyl)triazol-1-yl]methyl]-4-(trifluoromethyl)pyrrolidin-1-yl]-2-(5-bromo-2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 167962692 |
| Molecular Formula | C25H24BrF3N6O |
| Molecular Weight | 561.41 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | 1-[(3S,4S)-3-[[4-(4-aminophenyl)triazol-1-yl]methyl]-4-(trifluoromethyl)pyrrolidin-1-yl]-2-(5-bromo-2-methyl-1H-indol-3-yl)ethanone |
| SMILES | Cc1[nH]c2ccc(Br)cc2c1CC(=O)N1C[C@@H](Cn2cc(-c3ccc(N)cc3)nn2)[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C25H24BrF3N6O/c1-14-19(20-8-17(26)4-7-22(20)31-14)9-24(36)34-10-16(21(12-34)25(27,28)29)11-35-13-23(32-33-35)15-2-5-18(30)6-3-15/h2-8,13,16,21,31H,9-12,30H2,1H3/t16-,21+/m0/s1 |
| InChIKey | LTZBJESVWGRGAD-HRAATJIYSA-N |
| XLogP | 4.96 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|