C16H21N5O4S — CID 16796299
N-[[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]methyl]-N-methyl-5-nitropyridin-2-amine (PubChem CID 16796299) has the molecular formula C16H21N5O4S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]methyl]-N-methyl-5-nitropyridin-2-amine.
| Compound Name | N-[[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]methyl]-N-methyl-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 16796299 |
| Molecular Formula | C16H21N5O4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]methyl]-N-methyl-5-nitropyridin-2-amine |
| SMILES | Cc1nn(C2CCS(=O)(=O)C2)c(C)c1CN(C)c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C16H21N5O4S/c1-11-15(9-19(3)16-5-4-13(8-17-16)21(22)23)12(2)20(18-11)14-6-7-26(24,25)10-14/h4-5,8,14H,6-7,9-10H2,1-3H3 |
| InChIKey | ZINXKGORQAEHDI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 111.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|