C15H15ClF3N3O2 — CID 167963690
methyl 4-chloro-2-[[2-[3-(trifluoromethyl)diazirin-3-yl]pyrrolidin-1-yl]methyl]benzoate (PubChem CID 167963690) has the molecular formula C15H15ClF3N3O2 and a molecular weight of 361.75 g/mol. Its IUPAC name is methyl 4-chloro-2-[[2-[3-(trifluoromethyl)diazirin-3-yl]pyrrolidin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-chloro-2-[[2-[3-(trifluoromethyl)diazirin-3-yl]pyrrolidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 167963690 |
| Molecular Formula | C15H15ClF3N3O2 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | methyl 4-chloro-2-[[2-[3-(trifluoromethyl)diazirin-3-yl]pyrrolidin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1CN1CCCC1C1(C(F)(F)F)N=N1 |
| InChI | InChI=1S/C15H15ClF3N3O2/c1-24-13(23)11-5-4-10(16)7-9(11)8-22-6-2-3-12(22)14(20-21-14)15(17,18)19/h4-5,7,12H,2-3,6,8H2,1H3 |
| InChIKey | HSBRUABIEJBXEO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |