C17H21NO4 — CID 167963736
(2S,3S)-1-(2-cyclopentyloxyacetyl)-3-phenylazetidine-2-carboxylic acid (PubChem CID 167963736) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (2S,3S)-1-(2-cyclopentyloxyacetyl)-3-phenylazetidine-2-carboxylic acid.
| Compound Name | (2S,3S)-1-(2-cyclopentyloxyacetyl)-3-phenylazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 167963736 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (2S,3S)-1-(2-cyclopentyloxyacetyl)-3-phenylazetidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](c2ccccc2)CN1C(=O)COC1CCCC1 |
| InChI | InChI=1S/C17H21NO4/c19-15(11-22-13-8-4-5-9-13)18-10-14(16(18)17(20)21)12-6-2-1-3-7-12/h1-3,6-7,13-14,16H,4-5,8-11H2,(H,20,21)/t14-,16+/m1/s1 |
| InChIKey | OBEOCNUVGFGWIT-ZBFHGGJFSA-N |
| XLogP | 2.02 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |