About N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide
N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide (PubChem CID 167966103) has the molecular formula C9H9F4N3O2
and a molecular weight of 267.18 g/mol. Its IUPAC name is N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 167966103 |
| Molecular Formula | C9H9F4N3O2 |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(N[C@@H]1CNC[C@@H]1F)c1ncoc1C(F)(F)F |
| InChI | InChI=1S/C9H9F4N3O2/c10-4-1-14-2-5(4)16-8(17)6-7(9(11,12)13)18-3-15-6/h3-5,14H,1-2H2,(H,16,17)/t4-,5+/m0/s1 |
| InChIKey | YDAIUHFXRZOYMF-CRCLSJGQSA-N |
| XLogP | 0.73 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide?
The IUPAC name of N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide (CID 167966103) is N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide is O=C(N[C@@H]1CNC[C@@H]1F)c1ncoc1C(F)(F)F.
What is the InChIKey of N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide?
The InChIKey is YDAIUHFXRZOYMF-CRCLSJGQSA-N. The full InChI is InChI=1S/C9H9F4N3O2/c10-4-1-14-2-5(4)16-8(17)6-7(9(11,12)13)18-3-15-6/h3-5,14H,1-2H2,(H,16,17)/t4-,5+/m0/s1.
What are the key properties of N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide?
N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide has a molecular weight of 267.18 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4S)-4-fluoropyrrolidin-3-yl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 167966103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).