About 2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate
2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate (PubChem CID 167966285) has the molecular formula C13H12N4O4
and a molecular weight of 288.26 g/mol. Its IUPAC name is 2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate |
| PubChem CID | 167966285 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate |
| SMILES | COC(=O)c1nccnc1C(=O)OCc1ccc(C)nn1 |
| InChI | InChI=1S/C13H12N4O4/c1-8-3-4-9(17-16-8)7-21-13(19)11-10(12(18)20-2)14-5-6-15-11/h3-6H,7H2,1-2H3 |
| InChIKey | SYZMPQMFIPJEIW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 104.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate?
The IUPAC name of 2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate (CID 167966285) is 2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate.
What is the SMILES notation for 2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate?
The canonical SMILES for 2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate is COC(=O)c1nccnc1C(=O)OCc1ccc(C)nn1.
What is the InChIKey of 2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate?
The InChIKey is SYZMPQMFIPJEIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O4/c1-8-3-4-9(17-16-8)7-21-13(19)11-10(12(18)20-2)14-5-6-15-11/h3-6H,7H2,1-2H3.
What are the key properties of 2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate?
2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate has a molecular weight of 288.26 g/mol, XLogP of 0.72, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-methyl 3-O-[(6-methylpyridazin-3-yl)methyl] pyrazine-2,3-dicarboxylate is sourced from PubChem (CID 167966285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).