C23H26ClN3O3 — CID 167966334
1-[(2-chlorophenyl)-(3-methoxyphenyl)methyl]-3-[(2-oxo-1,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrol-6a-yl)methyl]urea (PubChem CID 167966334) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)-(3-methoxyphenyl)methyl]-3-[(2-oxo-1,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrol-6a-yl)methyl]urea.
| Compound Name | 1-[(2-chlorophenyl)-(3-methoxyphenyl)methyl]-3-[(2-oxo-1,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrol-6a-yl)methyl]urea |
|---|---|
| PubChem CID | 167966334 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-[(2-chlorophenyl)-(3-methoxyphenyl)methyl]-3-[(2-oxo-1,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrol-6a-yl)methyl]urea |
| SMILES | COc1cccc(C(NC(=O)NCC23CCCC2CC(=O)N3)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H26ClN3O3/c1-30-17-8-4-6-15(12-17)21(18-9-2-3-10-19(18)24)26-22(29)25-14-23-11-5-7-16(23)13-20(28)27-23/h2-4,6,8-10,12,16,21H,5,7,11,13-14H2,1H3,(H,27,28)(H2,25,26,29) |
| InChIKey | PSYNREWLWMMRKQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |