C20H22ClN3O3 — CID 167966362
N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-2-cyclopentyl-1,3-oxazole-4-carboxamide (PubChem CID 167966362) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-2-cyclopentyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-2-cyclopentyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 167966362 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-2-cyclopentyl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(CCl)N[C@@H]1c2ccccc2C[C@H]1NC(=O)c1coc(C2CCCC2)n1 |
| InChI | InChI=1S/C20H22ClN3O3/c21-10-17(25)24-18-14-8-4-3-7-13(14)9-15(18)22-19(26)16-11-27-20(23-16)12-5-1-2-6-12/h3-4,7-8,11-12,15,18H,1-2,5-6,9-10H2,(H,22,26)(H,24,25)/t15-,18-/m1/s1 |
| InChIKey | GQPZWSCZPDUSCQ-CRAIPNDOSA-N |
| XLogP | 3.08 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|