C20H20F3N5O3 — CID 167966415
3-methyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)-[2-(trifluoromethoxy)phenyl]methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide (PubChem CID 167966415) has the molecular formula C20H20F3N5O3 and a molecular weight of 435.41 g/mol. Its IUPAC name is 3-methyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)-[2-(trifluoromethoxy)phenyl]methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide.
| Compound Name | 3-methyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)-[2-(trifluoromethoxy)phenyl]methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 167966415 |
| Molecular Formula | C20H20F3N5O3 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 3-methyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)-[2-(trifluoromethoxy)phenyl]methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
| SMILES | Cc1nc(C(NC(=O)C2CCn3c(cnc3C)C2)c2ccccc2OC(F)(F)F)no1 |
| InChI | InChI=1S/C20H20F3N5O3/c1-11-24-10-14-9-13(7-8-28(11)14)19(29)26-17(18-25-12(2)31-27-18)15-5-3-4-6-16(15)30-20(21,22)23/h3-6,10,13,17H,7-9H2,1-2H3,(H,26,29) |
| InChIKey | PJAWRJAZFIKEFX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |