C15H18ClN5O2 — CID 167966457
methyl 2-chloro-3-[[2-(2H-tetrazol-5-yl)piperidin-1-yl]methyl]benzoate (PubChem CID 167966457) has the molecular formula C15H18ClN5O2 and a molecular weight of 335.80 g/mol. Its IUPAC name is methyl 2-chloro-3-[[2-(2H-tetrazol-5-yl)piperidin-1-yl]methyl]benzoate.
| Compound Name | methyl 2-chloro-3-[[2-(2H-tetrazol-5-yl)piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 167966457 |
| Molecular Formula | C15H18ClN5O2 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | methyl 2-chloro-3-[[2-(2H-tetrazol-5-yl)piperidin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CN2CCCCC2c2nn[nH]n2)c1Cl |
| InChI | InChI=1S/C15H18ClN5O2/c1-23-15(22)11-6-4-5-10(13(11)16)9-21-8-3-2-7-12(21)14-17-19-20-18-14/h4-6,12H,2-3,7-9H2,1H3,(H,17,18,19,20) |
| InChIKey | TUQCQYVUWGYCOU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |