C20H26N2O — CID 167966541
2,6-dimethyl-3-[[4-(piperidin-3-ylmethyl)phenoxy]methyl]pyridine (PubChem CID 167966541) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 2,6-dimethyl-3-[[4-(piperidin-3-ylmethyl)phenoxy]methyl]pyridine.
| Compound Name | 2,6-dimethyl-3-[[4-(piperidin-3-ylmethyl)phenoxy]methyl]pyridine |
|---|---|
| PubChem CID | 167966541 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 2,6-dimethyl-3-[[4-(piperidin-3-ylmethyl)phenoxy]methyl]pyridine |
| SMILES | Cc1ccc(COc2ccc(CC3CCCNC3)cc2)c(C)n1 |
| InChI | InChI=1S/C20H26N2O/c1-15-5-8-19(16(2)22-15)14-23-20-9-6-17(7-10-20)12-18-4-3-11-21-13-18/h5-10,18,21H,3-4,11-14H2,1-2H3 |
| InChIKey | BMQPUWKMRPCJTM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |