C16H16N4O2 — CID 167966565
5-(2-methylquinolin-4-yl)-N-(oxolan-3-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 167966565) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 5-(2-methylquinolin-4-yl)-N-(oxolan-3-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-methylquinolin-4-yl)-N-(oxolan-3-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 167966565 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 5-(2-methylquinolin-4-yl)-N-(oxolan-3-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | Cc1cc(-c2nnc(NC3CCOC3)o2)c2ccccc2n1 |
| InChI | InChI=1S/C16H16N4O2/c1-10-8-13(12-4-2-3-5-14(12)17-10)15-19-20-16(22-15)18-11-6-7-21-9-11/h2-5,8,11H,6-7,9H2,1H3,(H,18,20) |
| InChIKey | HUXGRRXTGPUSPQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |