C18H17F3N2O4 — CID 167966568
N-[2-[[but-2-ynoyl(methyl)amino]methyl]phenyl]but-2-ynamide;2,2,2-trifluoroacetic acid (PubChem CID 167966568) has the molecular formula C18H17F3N2O4 and a molecular weight of 382.34 g/mol. Its IUPAC name is N-[2-[[but-2-ynoyl(methyl)amino]methyl]phenyl]but-2-ynamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[[but-2-ynoyl(methyl)amino]methyl]phenyl]but-2-ynamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167966568 |
| Molecular Formula | C18H17F3N2O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N-[2-[[but-2-ynoyl(methyl)amino]methyl]phenyl]but-2-ynamide;2,2,2-trifluoroacetic acid |
| SMILES | CC#CC(=O)Nc1ccccc1CN(C)C(=O)C#CC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H16N2O2.C2HF3O2/c1-4-8-15(19)17-14-11-7-6-10-13(14)12-18(3)16(20)9-5-2;3-2(4,5)1(6)7/h6-7,10-11H,12H2,1-3H3,(H,17,19);(H,6,7) |
| InChIKey | FKTMRHFWXCGPBI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|