About methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate
methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate (PubChem CID 167966677) has the molecular formula C12H17F2NO3
and a molecular weight of 261.27 g/mol. Its IUPAC name is methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate |
| PubChem CID | 167966677 |
| Molecular Formula | C12H17F2NO3 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)CCC1CC(F)(F)C1 |
| InChI | InChI=1S/C12H17F2NO3/c1-18-11(17)3-2-6-15-10(16)5-4-9-7-12(13,14)8-9/h2-3,9H,4-8H2,1H3,(H,15,16)/b3-2+ |
| InChIKey | FRBVAMTUVDSSIP-NSCUHMNNSA-N |
| XLogP | 1.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate?
The IUPAC name of methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate (CID 167966677) is methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate.
What is the SMILES notation for methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate?
The canonical SMILES for methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate is COC(=O)/C=C/CNC(=O)CCC1CC(F)(F)C1.
What is the InChIKey of methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate?
The InChIKey is FRBVAMTUVDSSIP-NSCUHMNNSA-N. The full InChI is InChI=1S/C12H17F2NO3/c1-18-11(17)3-2-6-15-10(16)5-4-9-7-12(13,14)8-9/h2-3,9H,4-8H2,1H3,(H,15,16)/b3-2+.
What are the key properties of methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate?
methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate has a molecular weight of 261.27 g/mol, XLogP of 1.66, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-[3-(3,3-difluorocyclobutyl)propanoylamino]but-2-enoate is sourced from PubChem (CID 167966677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).