C23H25N3O3 — CID 167966694
3-methyl-2-[(2-phenoxyacetyl)amino]-N-(4-pyrrol-1-ylphenyl)butanamide (PubChem CID 167966694) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-methyl-2-[(2-phenoxyacetyl)amino]-N-(4-pyrrol-1-ylphenyl)butanamide.
| Compound Name | 3-methyl-2-[(2-phenoxyacetyl)amino]-N-(4-pyrrol-1-ylphenyl)butanamide |
|---|---|
| PubChem CID | 167966694 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 3-methyl-2-[(2-phenoxyacetyl)amino]-N-(4-pyrrol-1-ylphenyl)butanamide |
| SMILES | CC(C)C(NC(=O)COc1ccccc1)C(=O)Nc1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-17(2)22(25-21(27)16-29-20-8-4-3-5-9-20)23(28)24-18-10-12-19(13-11-18)26-14-6-7-15-26/h3-15,17,22H,16H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | GSDHLBKBJGJHTH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |