C16H20N4O2S — CID 167967042
N-(1,1-dioxothian-4-yl)-5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine (PubChem CID 167967042) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 167967042 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine |
| SMILES | Cc1nc(-c2cccnc2)nc(NC2CCS(=O)(=O)CC2)c1C |
| InChI | InChI=1S/C16H20N4O2S/c1-11-12(2)18-16(13-4-3-7-17-10-13)20-15(11)19-14-5-8-23(21,22)9-6-14/h3-4,7,10,14H,5-6,8-9H2,1-2H3,(H,18,19,20) |
| InChIKey | IXFCFLZWXYFNDL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |