C15H20N4O2S — CID 167967192
N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-oxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrimidine-1-carboxamide (PubChem CID 167967192) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-oxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrimidine-1-carboxamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-oxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 167967192 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-oxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrimidine-1-carboxamide |
| SMILES | O=C1CCN(C(=O)Nc2nc(C3CC3)cs2)C2CCCCN12 |
| InChI | InChI=1S/C15H20N4O2S/c20-13-6-8-19(12-3-1-2-7-18(12)13)15(21)17-14-16-11(9-22-14)10-4-5-10/h9-10,12H,1-8H2,(H,16,17,21) |
| InChIKey | YSDDLLKSSYFRJH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |