About 5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one
5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one (PubChem CID 167967310) has the molecular formula C15H16N4O3S
and a molecular weight of 332.38 g/mol. Its IUPAC name is 5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one.
Molecular Properties
| Compound Name | 5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one |
| PubChem CID | 167967310 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one |
| SMILES | Cc1cccc(S(=O)(=O)CCCn2ncc3[nH]cnc3c2=O)c1 |
| InChI | InChI=1S/C15H16N4O3S/c1-11-4-2-5-12(8-11)23(21,22)7-3-6-19-15(20)14-13(9-18-19)16-10-17-14/h2,4-5,8-10H,3,6-7H2,1H3,(H,16,17) |
| InChIKey | LTEXDVMDBQFYJI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one?
The IUPAC name of 5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one (CID 167967310) is 5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one.
What is the SMILES notation for 5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one?
The canonical SMILES for 5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one is Cc1cccc(S(=O)(=O)CCCn2ncc3[nH]cnc3c2=O)c1.
What is the InChIKey of 5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one?
The InChIKey is LTEXDVMDBQFYJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O3S/c1-11-4-2-5-12(8-11)23(21,22)7-3-6-19-15(20)14-13(9-18-19)16-10-17-14/h2,4-5,8-10H,3,6-7H2,1H3,(H,16,17).
What are the key properties of 5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one?
5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one has a molecular weight of 332.38 g/mol, XLogP of 1.29, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(3-methylphenyl)sulfonylpropyl]-1H-imidazo[4,5-d]pyridazin-4-one is sourced from PubChem (CID 167967310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).