C11H19F4NO3S — CID 167967564
3,3,4,4-tetrafluoro-2-methyl-N-(2-methylsulfonylethyl)-N-propan-2-ylbutanamide (PubChem CID 167967564) has the molecular formula C11H19F4NO3S and a molecular weight of 321.34 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-2-methyl-N-(2-methylsulfonylethyl)-N-propan-2-ylbutanamide.
| Compound Name | 3,3,4,4-tetrafluoro-2-methyl-N-(2-methylsulfonylethyl)-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 167967564 |
| Molecular Formula | C11H19F4NO3S |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3,3,4,4-tetrafluoro-2-methyl-N-(2-methylsulfonylethyl)-N-propan-2-ylbutanamide |
| SMILES | CC(C)N(CCS(C)(=O)=O)C(=O)C(C)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H19F4NO3S/c1-7(2)16(5-6-20(4,18)19)9(17)8(3)11(14,15)10(12)13/h7-8,10H,5-6H2,1-4H3 |
| InChIKey | MYHWDPUHYFEKTI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|