About 2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide
2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide (PubChem CID 167967580) has the molecular formula C20H25N3O2
and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide.
Molecular Properties
| Compound Name | 2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide |
| PubChem CID | 167967580 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide |
| SMILES | CCCCc1oc2ccccc2c1C(=O)NCCn1cnc(C)c1C |
| InChI | InChI=1S/C20H25N3O2/c1-4-5-9-18-19(16-8-6-7-10-17(16)25-18)20(24)21-11-12-23-13-22-14(2)15(23)3/h6-8,10,13H,4-5,9,11-12H2,1-3H3,(H,21,24) |
| InChIKey | NCXLYTQGSZSDOU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide?
The IUPAC name of 2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide (CID 167967580) is 2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide.
What is the SMILES notation for 2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide?
The canonical SMILES for 2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide is CCCCc1oc2ccccc2c1C(=O)NCCn1cnc(C)c1C.
What is the InChIKey of 2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide?
The InChIKey is NCXLYTQGSZSDOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O2/c1-4-5-9-18-19(16-8-6-7-10-17(16)25-18)20(24)21-11-12-23-13-22-14(2)15(23)3/h6-8,10,13H,4-5,9,11-12H2,1-3H3,(H,21,24).
What are the key properties of 2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide?
2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide has a molecular weight of 339.44 g/mol, XLogP of 4.02, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-1-benzofuran-3-carboxamide is sourced from PubChem (CID 167967580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).