About 2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide
2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide (PubChem CID 167967990) has the molecular formula C13H20F2N4O3S
and a molecular weight of 350.39 g/mol. Its IUPAC name is 2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide.
Molecular Properties
| Compound Name | 2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide |
| PubChem CID | 167967990 |
| Molecular Formula | C13H20F2N4O3S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide |
| SMILES | Cn1ccc(CS(=O)(=O)NC(=O)C(N)C2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C13H20F2N4O3S/c1-19-7-4-10(17-19)8-23(21,22)18-12(20)11(16)9-2-5-13(14,15)6-3-9/h4,7,9,11H,2-3,5-6,8,16H2,1H3,(H,18,20) |
| InChIKey | KMNYEEFSFMQGGH-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide?
The IUPAC name of 2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide (CID 167967990) is 2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide.
What is the SMILES notation for 2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide?
The canonical SMILES for 2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide is Cn1ccc(CS(=O)(=O)NC(=O)C(N)C2CCC(F)(F)CC2)n1.
What is the InChIKey of 2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide?
The InChIKey is KMNYEEFSFMQGGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N4O3S/c1-19-7-4-10(17-19)8-23(21,22)18-12(20)11(16)9-2-5-13(14,15)6-3-9/h4,7,9,11H,2-3,5-6,8,16H2,1H3,(H,18,20).
What are the key properties of 2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide?
2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide has a molecular weight of 350.39 g/mol, XLogP of 0.52, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(4,4-difluorocyclohexyl)-N-[(1-methylpyrazol-3-yl)methylsulfonyl]acetamide is sourced from PubChem (CID 167967990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).