C21H17N5O2S — CID 167968258
5-methyl-1-(6-oxo-1H-pyridazin-3-yl)-N-(2-phenylsulfanylphenyl)pyrazole-4-carboxamide (PubChem CID 167968258) has the molecular formula C21H17N5O2S and a molecular weight of 403.47 g/mol. Its IUPAC name is 5-methyl-1-(6-oxo-1H-pyridazin-3-yl)-N-(2-phenylsulfanylphenyl)pyrazole-4-carboxamide.
| Compound Name | 5-methyl-1-(6-oxo-1H-pyridazin-3-yl)-N-(2-phenylsulfanylphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167968258 |
| Molecular Formula | C21H17N5O2S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 5-methyl-1-(6-oxo-1H-pyridazin-3-yl)-N-(2-phenylsulfanylphenyl)pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2Sc2ccccc2)cnn1-c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C21H17N5O2S/c1-14-16(13-22-26(14)19-11-12-20(27)25-24-19)21(28)23-17-9-5-6-10-18(17)29-15-7-3-2-4-8-15/h2-13H,1H3,(H,23,28)(H,25,27) |
| InChIKey | CQSAEQZNGJOYGG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |