C37H47N5O2 — CID 167968917
N,N-diethyl-4-[(E)-[2-morpholin-4-yl-3-[(E)-[(E)-(2-morpholin-4-yl-3-phenylcyclopenten-1-yl)methylidenehydrazinylidene]methyl]cyclopent-2-en-1-ylidene]methyl]aniline (PubChem CID 167968917) has the molecular formula C37H47N5O2 and a molecular weight of 593.82 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-[2-morpholin-4-yl-3-[(E)-[(E)-(2-morpholin-4-yl-3-phenylcyclopenten-1-yl)methylidenehydrazinylidene]methyl]cyclopent-2-en-1-ylidene]methyl]aniline.
| Compound Name | N,N-diethyl-4-[(E)-[2-morpholin-4-yl-3-[(E)-[(E)-(2-morpholin-4-yl-3-phenylcyclopenten-1-yl)methylidenehydrazinylidene]methyl]cyclopent-2-en-1-ylidene]methyl]aniline |
|---|---|
| PubChem CID | 167968917 |
| Molecular Formula | C37H47N5O2 |
| Molecular Weight | 593.82 g/mol |
| Exact Mass | 593.37 |
| IUPAC Name | N,N-diethyl-4-[(E)-[2-morpholin-4-yl-3-[(E)-[(E)-(2-morpholin-4-yl-3-phenylcyclopenten-1-yl)methylidenehydrazinylidene]methyl]cyclopent-2-en-1-ylidene]methyl]aniline |
| SMILES | CCN(CC)c1ccc(/C=C2\CCC(/C=N/N=C/C3=C(N4CCOCC4)C(c4ccccc4)CC3)=C2N2CCOCC2)cc1 |
| InChI | InChI=1S/C37H47N5O2/c1-3-40(4-2)34-15-10-29(11-16-34)26-31-12-13-32(36(31)41-18-22-43-23-19-41)27-38-39-28-33-14-17-35(30-8-6-5-7-9-30)37(33)42-20-24-44-25-21-42/h5-11,15-16,26-28,35H,3-4,12-14,17-25H2,1-2H3/b31-26+,38-27+,39-28+ |
| InChIKey | PPFGFWOBJFZERX-DVNFWBFDSA-N |
| XLogP | 6.52 |
| TPSA | 52.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.82 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|