About 3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one
3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one (PubChem CID 167969229) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is 3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one |
| PubChem CID | 167969229 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one |
| SMILES | C[C@@H]1CC(Cn2cncc(-c3ccccc3)c2=O)C[C@H](C)O1 |
| InChI | InChI=1S/C18H22N2O2/c1-13-8-15(9-14(2)22-13)11-20-12-19-10-17(18(20)21)16-6-4-3-5-7-16/h3-7,10,12-15H,8-9,11H2,1-2H3/t13-,14+,15? |
| InChIKey | OPEOWWNJSSHEIY-YIONKMFJSA-N |
| XLogP | 3.11 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one?
The IUPAC name of 3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one (CID 167969229) is 3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one.
What is the SMILES notation for 3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one?
The canonical SMILES for 3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one is C[C@@H]1CC(Cn2cncc(-c3ccccc3)c2=O)C[C@H](C)O1.
What is the InChIKey of 3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one?
The InChIKey is OPEOWWNJSSHEIY-YIONKMFJSA-N. The full InChI is InChI=1S/C18H22N2O2/c1-13-8-15(9-14(2)22-13)11-20-12-19-10-17(18(20)21)16-6-4-3-5-7-16/h3-7,10,12-15H,8-9,11H2,1-2H3/t13-,14+,15?.
What are the key properties of 3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one?
3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one has a molecular weight of 298.39 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]-5-phenylpyrimidin-4-one is sourced from PubChem (CID 167969229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).