C19H21F5N4O4S — CID 167969641
N-[[(2S,3R)-2-(1,5-dimethylpyrazol-4-yl)-1-(2-methoxyethyl)-5-oxopyrrolidin-3-yl]methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide (PubChem CID 167969641) has the molecular formula C19H21F5N4O4S and a molecular weight of 496.46 g/mol. Its IUPAC name is N-[[(2S,3R)-2-(1,5-dimethylpyrazol-4-yl)-1-(2-methoxyethyl)-5-oxopyrrolidin-3-yl]methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide.
| Compound Name | N-[[(2S,3R)-2-(1,5-dimethylpyrazol-4-yl)-1-(2-methoxyethyl)-5-oxopyrrolidin-3-yl]methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 167969641 |
| Molecular Formula | C19H21F5N4O4S |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | N-[[(2S,3R)-2-(1,5-dimethylpyrazol-4-yl)-1-(2-methoxyethyl)-5-oxopyrrolidin-3-yl]methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide |
| SMILES | COCCN1C(=O)C[C@H](CNS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)[C@H]1c1cnn(C)c1C |
| InChI | InChI=1S/C19H21F5N4O4S/c1-9-11(8-25-27(9)2)18-10(6-12(29)28(18)4-5-32-3)7-26-33(30,31)19-16(23)14(21)13(20)15(22)17(19)24/h8,10,18,26H,4-7H2,1-3H3/t10-,18+/m1/s1 |
| InChIKey | RTNNGMMYBAGXGW-MGNBDDOMSA-N |
| XLogP | 1.94 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|