C11H11ClN2O — CID 167970186
2-chloro-N-[(5-methyl-1,3-oxazol-2-yl)methyl]aniline (PubChem CID 167970186) has the molecular formula C11H11ClN2O and a molecular weight of 222.68 g/mol. Its IUPAC name is 2-chloro-N-[(5-methyl-1,3-oxazol-2-yl)methyl]aniline.
| Compound Name | 2-chloro-N-[(5-methyl-1,3-oxazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 167970186 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-chloro-N-[(5-methyl-1,3-oxazol-2-yl)methyl]aniline |
| SMILES | Cc1cnc(CNc2ccccc2Cl)o1 |
| InChI | InChI=1S/C11H11ClN2O/c1-8-6-14-11(15-8)7-13-10-5-3-2-4-9(10)12/h2-6,13H,7H2,1H3 |
| InChIKey | CGCNBRNQEHAHQD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |