C16H17F2N3O2 — CID 167970949
4-[[4-(4,4-difluorocyclohexyl)triazol-1-yl]methyl]benzoic acid (PubChem CID 167970949) has the molecular formula C16H17F2N3O2 and a molecular weight of 321.33 g/mol. Its IUPAC name is 4-[[4-(4,4-difluorocyclohexyl)triazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-(4,4-difluorocyclohexyl)triazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 167970949 |
| Molecular Formula | C16H17F2N3O2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 4-[[4-(4,4-difluorocyclohexyl)triazol-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cn2cc(C3CCC(F)(F)CC3)nn2)cc1 |
| InChI | InChI=1S/C16H17F2N3O2/c17-16(18)7-5-12(6-8-16)14-10-21(20-19-14)9-11-1-3-13(4-2-11)15(22)23/h1-4,10,12H,5-9H2,(H,22,23) |
| InChIKey | YGINSEGTWXRDQC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |