About 3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one
3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one (PubChem CID 167972671) has the molecular formula C15H16ClN3O2
and a molecular weight of 305.77 g/mol. Its IUPAC name is 3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one |
| PubChem CID | 167972671 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]nc(Cl)cc1NC[C@@H]1C[C@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-14-7-13(15(20)19-18-14)17-8-12-6-11(9-21-12)10-4-2-1-3-5-10/h1-5,7,11-12H,6,8-9H2,(H,17,18)(H,19,20)/t11-,12-/m0/s1 |
| InChIKey | NBERUKBOQXWKDA-RYUDHWBXSA-N |
| XLogP | 2.41 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one?
The IUPAC name of 3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one (CID 167972671) is 3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one.
What is the SMILES notation for 3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one?
The canonical SMILES for 3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one is O=c1[nH]nc(Cl)cc1NC[C@@H]1C[C@H](c2ccccc2)CO1.
What is the InChIKey of 3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one?
The InChIKey is NBERUKBOQXWKDA-RYUDHWBXSA-N. The full InChI is InChI=1S/C15H16ClN3O2/c16-14-7-13(15(20)19-18-14)17-8-12-6-11(9-21-12)10-4-2-1-3-5-10/h1-5,7,11-12H,6,8-9H2,(H,17,18)(H,19,20)/t11-,12-/m0/s1.
What are the key properties of 3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one?
3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one has a molecular weight of 305.77 g/mol, XLogP of 2.41, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]-1H-pyridazin-6-one is sourced from PubChem (CID 167972671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).