About 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine
2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine (PubChem CID 167972774) has the molecular formula C13H15N5O2
and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine.
Molecular Properties
| Compound Name | 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine |
| PubChem CID | 167972774 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine |
| SMILES | c1cnnc(N2CCOC(c3nc(C4CC4)no3)C2)c1 |
| InChI | InChI=1S/C13H15N5O2/c1-2-11(16-14-5-1)18-6-7-19-10(8-18)13-15-12(17-20-13)9-3-4-9/h1-2,5,9-10H,3-4,6-8H2 |
| InChIKey | QPNRYDHVEZDSNF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 77.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine?
The IUPAC name of 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine (CID 167972774) is 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine.
What is the SMILES notation for 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine?
The canonical SMILES for 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine is c1cnnc(N2CCOC(c3nc(C4CC4)no3)C2)c1.
What is the InChIKey of 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine?
The InChIKey is QPNRYDHVEZDSNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5O2/c1-2-11(16-14-5-1)18-6-7-19-10(8-18)13-15-12(17-20-13)9-3-4-9/h1-2,5,9-10H,3-4,6-8H2.
What are the key properties of 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine?
2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine has a molecular weight of 273.30 g/mol, XLogP of 1.31, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4-pyridazin-3-ylmorpholine is sourced from PubChem (CID 167972774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).