C23H28N8O — CID 167973025
(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-[1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidin-4-yl]methanone (PubChem CID 167973025) has the molecular formula C23H28N8O and a molecular weight of 432.53 g/mol. Its IUPAC name is (2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-[1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidin-4-yl]methanone.
| Compound Name | (2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-[1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 167973025 |
| Molecular Formula | C23H28N8O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-[1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidin-4-yl]methanone |
| SMILES | Cc1ccc2c(c1)C1CN(C)CCC1N2C(=O)C1CCN(c2ccc3nnnn3n2)CC1 |
| InChI | InChI=1S/C23H28N8O/c1-15-3-4-19-17(13-15)18-14-28(2)10-9-20(18)30(19)23(32)16-7-11-29(12-8-16)22-6-5-21-24-26-27-31(21)25-22/h3-6,13,16,18,20H,7-12,14H2,1-2H3 |
| InChIKey | MGXLQVKHFUEHHB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 82.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |