C14H17BrN4O2 — CID 167973223
5-bromo-4-[[[4-(dimethylamino)pyrimidin-2-yl]amino]methyl]-2-methoxyphenol (PubChem CID 167973223) has the molecular formula C14H17BrN4O2 and a molecular weight of 353.22 g/mol. Its IUPAC name is 5-bromo-4-[[[4-(dimethylamino)pyrimidin-2-yl]amino]methyl]-2-methoxyphenol.
| Compound Name | 5-bromo-4-[[[4-(dimethylamino)pyrimidin-2-yl]amino]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 167973223 |
| Molecular Formula | C14H17BrN4O2 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 5-bromo-4-[[[4-(dimethylamino)pyrimidin-2-yl]amino]methyl]-2-methoxyphenol |
| SMILES | COc1cc(CNc2nccc(N(C)C)n2)c(Br)cc1O |
| InChI | InChI=1S/C14H17BrN4O2/c1-19(2)13-4-5-16-14(18-13)17-8-9-6-12(21-3)11(20)7-10(9)15/h4-7,20H,8H2,1-3H3,(H,16,17,18) |
| InChIKey | AUYPITFSWDJWCD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |