C22H22F3N3O2 — CID 167973431
1-methyl-N-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]indole-3-carboxamide (PubChem CID 167973431) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is 1-methyl-N-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]indole-3-carboxamide.
| Compound Name | 1-methyl-N-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 167973431 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-methyl-N-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]indole-3-carboxamide |
| SMILES | Cn1cc(C(=O)NCc2ccc(N3CCOCC3)cc2C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C22H22F3N3O2/c1-27-14-18(17-4-2-3-5-20(17)27)21(29)26-13-15-6-7-16(12-19(15)22(23,24)25)28-8-10-30-11-9-28/h2-7,12,14H,8-11,13H2,1H3,(H,26,29) |
| InChIKey | YPQKKFVKQFTPLW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |