About 4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol
4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol (PubChem CID 167974820) has the molecular formula C11H15BrN4O
and a molecular weight of 299.17 g/mol. Its IUPAC name is 4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol.
Molecular Properties
| Compound Name | 4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol |
| PubChem CID | 167974820 |
| Molecular Formula | C11H15BrN4O |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol |
| SMILES | CC(CCCO)Nc1ccn2ncc(Br)c2n1 |
| InChI | InChI=1S/C11H15BrN4O/c1-8(3-2-6-17)14-10-4-5-16-11(15-10)9(12)7-13-16/h4-5,7-8,17H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | DBEHJUJMXRSDRT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol?
The IUPAC name of 4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol (CID 167974820) is 4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol.
What is the SMILES notation for 4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol?
The canonical SMILES for 4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol is CC(CCCO)Nc1ccn2ncc(Br)c2n1.
What is the InChIKey of 4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol?
The InChIKey is DBEHJUJMXRSDRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN4O/c1-8(3-2-6-17)14-10-4-5-16-11(15-10)9(12)7-13-16/h4-5,7-8,17H,2-3,6H2,1H3,(H,14,15).
What are the key properties of 4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol?
4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol has a molecular weight of 299.17 g/mol, XLogP of 2.06, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)amino]pentan-1-ol is sourced from PubChem (CID 167974820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).