About 3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine
3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine (PubChem CID 167974869) has the molecular formula C10H13ClF2N4O
and a molecular weight of 278.69 g/mol. Its IUPAC name is 3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine |
| PubChem CID | 167974869 |
| Molecular Formula | C10H13ClF2N4O |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine |
| SMILES | CO[C@H]1CN(c2cnc(N)c(Cl)n2)CC(F)(F)C1 |
| InChI | InChI=1S/C10H13ClF2N4O/c1-18-6-2-10(12,13)5-17(4-6)7-3-15-9(14)8(11)16-7/h3,6H,2,4-5H2,1H3,(H2,14,15)/t6-/m1/s1 |
| InChIKey | ANJDUDDXNXJZNE-ZCFIWIBFSA-N |
| XLogP | 1.57 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine?
The IUPAC name of 3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine (CID 167974869) is 3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine.
What is the SMILES notation for 3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine?
The canonical SMILES for 3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine is CO[C@H]1CN(c2cnc(N)c(Cl)n2)CC(F)(F)C1.
What is the InChIKey of 3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine?
The InChIKey is ANJDUDDXNXJZNE-ZCFIWIBFSA-N. The full InChI is InChI=1S/C10H13ClF2N4O/c1-18-6-2-10(12,13)5-17(4-6)7-3-15-9(14)8(11)16-7/h3,6H,2,4-5H2,1H3,(H2,14,15)/t6-/m1/s1.
What are the key properties of 3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine?
3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine has a molecular weight of 278.69 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-[(5R)-3,3-difluoro-5-methoxypiperidin-1-yl]pyrazin-2-amine is sourced from PubChem (CID 167974869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).