About 3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one
3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one (PubChem CID 167975912) has the molecular formula C20H24N2O4
and a molecular weight of 356.42 g/mol. Its IUPAC name is 3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one.
Molecular Properties
| Compound Name | 3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one |
| PubChem CID | 167975912 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one |
| SMILES | CN1CCN(C(=O)c2cc3ccccc3oc2=O)C2(CCOCC2)CC1 |
| InChI | InChI=1S/C20H24N2O4/c1-21-9-6-20(7-12-25-13-8-20)22(11-10-21)18(23)16-14-15-4-2-3-5-17(15)26-19(16)24/h2-5,14H,6-13H2,1H3 |
| InChIKey | LSJXLGAMQXNQII-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one?
The IUPAC name of 3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one (CID 167975912) is 3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one.
What is the SMILES notation for 3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one?
The canonical SMILES for 3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one is CN1CCN(C(=O)c2cc3ccccc3oc2=O)C2(CCOCC2)CC1.
What is the InChIKey of 3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one?
The InChIKey is LSJXLGAMQXNQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O4/c1-21-9-6-20(7-12-25-13-8-20)22(11-10-21)18(23)16-14-15-4-2-3-5-17(15)26-19(16)24/h2-5,14H,6-13H2,1H3.
What are the key properties of 3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one?
3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one has a molecular weight of 356.42 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(10-methyl-3-oxa-7,10-diazaspiro[5.6]dodecane-7-carbonyl)chromen-2-one is sourced from PubChem (CID 167975912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).