C15H19N3O3 — CID 167976133
(2S)-2-methoxy-N-(6-prop-2-enoyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)propanamide (PubChem CID 167976133) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is (2S)-2-methoxy-N-(6-prop-2-enoyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)propanamide.
| Compound Name | (2S)-2-methoxy-N-(6-prop-2-enoyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)propanamide |
|---|---|
| PubChem CID | 167976133 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (2S)-2-methoxy-N-(6-prop-2-enoyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)propanamide |
| SMILES | C=CC(=O)N1CCc2ncc(NC(=O)[C@H](C)OC)cc2C1 |
| InChI | InChI=1S/C15H19N3O3/c1-4-14(19)18-6-5-13-11(9-18)7-12(8-16-13)17-15(20)10(2)21-3/h4,7-8,10H,1,5-6,9H2,2-3H3,(H,17,20)/t10-/m0/s1 |
| InChIKey | CYCTYCAYOYFANG-JTQLQIEISA-N |
| XLogP | 1.13 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|