C19H22N2O4 — CID 167976323
ethyl 5-[(1-hydroxy-2-phenylpropan-2-yl)carbamoyl]-6-methylpyridine-3-carboxylate (PubChem CID 167976323) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is ethyl 5-[(1-hydroxy-2-phenylpropan-2-yl)carbamoyl]-6-methylpyridine-3-carboxylate.
| Compound Name | ethyl 5-[(1-hydroxy-2-phenylpropan-2-yl)carbamoyl]-6-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 167976323 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | ethyl 5-[(1-hydroxy-2-phenylpropan-2-yl)carbamoyl]-6-methylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(C)c(C(=O)NC(C)(CO)c2ccccc2)c1 |
| InChI | InChI=1S/C19H22N2O4/c1-4-25-18(24)14-10-16(13(2)20-11-14)17(23)21-19(3,12-22)15-8-6-5-7-9-15/h5-11,22H,4,12H2,1-3H3,(H,21,23) |
| InChIKey | UJKSEOMMGAQGCR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |