C17H23FN2O2 — CID 167976334
N-[[(2S)-1-butanoylpyrrolidin-2-yl]methyl]-3-fluoro-4-methylbenzamide (PubChem CID 167976334) has the molecular formula C17H23FN2O2 and a molecular weight of 306.38 g/mol. Its IUPAC name is N-[[(2S)-1-butanoylpyrrolidin-2-yl]methyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[[(2S)-1-butanoylpyrrolidin-2-yl]methyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 167976334 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N-[[(2S)-1-butanoylpyrrolidin-2-yl]methyl]-3-fluoro-4-methylbenzamide |
| SMILES | CCCC(=O)N1CCC[C@H]1CNC(=O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C17H23FN2O2/c1-3-5-16(21)20-9-4-6-14(20)11-19-17(22)13-8-7-12(2)15(18)10-13/h7-8,10,14H,3-6,9,11H2,1-2H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | ADVPHLHBAOBJNJ-AWEZNQCLSA-N |
| XLogP | 2.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |