C14H24N2O3 — CID 167977859
methyl (E)-4-[2-(azepan-1-yl)propanoylamino]but-2-enoate (PubChem CID 167977859) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is methyl (E)-4-[2-(azepan-1-yl)propanoylamino]but-2-enoate.
| Compound Name | methyl (E)-4-[2-(azepan-1-yl)propanoylamino]but-2-enoate |
|---|---|
| PubChem CID | 167977859 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | methyl (E)-4-[2-(azepan-1-yl)propanoylamino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)C(C)N1CCCCCC1 |
| InChI | InChI=1S/C14H24N2O3/c1-12(16-10-5-3-4-6-11-16)14(18)15-9-7-8-13(17)19-2/h7-8,12H,3-6,9-11H2,1-2H3,(H,15,18)/b8-7+ |
| InChIKey | MRIWLOOECWEJLQ-BQYQJAHWSA-N |
| XLogP | 1.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|