C23H24ClN5O2 — CID 167978791
N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-3-(2-chlorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 167978791) has the molecular formula C23H24ClN5O2 and a molecular weight of 437.93 g/mol. Its IUPAC name is N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-3-(2-chlorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-3-(2-chlorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 167978791 |
| Molecular Formula | C23H24ClN5O2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-3-(2-chlorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(CN1CCC(NC(=O)c2cc(-c3ccccc3Cl)n[nH]2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C23H24ClN5O2/c24-19-9-5-4-8-18(19)20-14-21(28-27-20)23(31)26-17-10-12-29(13-11-17)15-22(30)25-16-6-2-1-3-7-16/h1-9,14,17H,10-13,15H2,(H,25,30)(H,26,31)(H,27,28) |
| InChIKey | FBSJMBNEPYSITQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |