C20H20N4 — CID 167980095
1-(1H-indol-7-yl)-N-[[1-(3-methylphenyl)pyrazol-4-yl]methyl]methanamine (PubChem CID 167980095) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-(1H-indol-7-yl)-N-[[1-(3-methylphenyl)pyrazol-4-yl]methyl]methanamine.
| Compound Name | 1-(1H-indol-7-yl)-N-[[1-(3-methylphenyl)pyrazol-4-yl]methyl]methanamine |
|---|---|
| PubChem CID | 167980095 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-(1H-indol-7-yl)-N-[[1-(3-methylphenyl)pyrazol-4-yl]methyl]methanamine |
| SMILES | Cc1cccc(-n2cc(CNCc3cccc4cc[nH]c34)cn2)c1 |
| InChI | InChI=1S/C20H20N4/c1-15-4-2-7-19(10-15)24-14-16(12-23-24)11-21-13-18-6-3-5-17-8-9-22-20(17)18/h2-10,12,14,21-22H,11,13H2,1H3 |
| InChIKey | LJBJBBUNYQBLSK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |