About 3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol
3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol (PubChem CID 167980448) has the molecular formula C20H29NO4
and a molecular weight of 347.45 g/mol. Its IUPAC name is 3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol.
Molecular Properties
| Compound Name | 3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol |
| PubChem CID | 167980448 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol |
| SMILES | Oc1cccc(CN(CC2CCC3(COC3)O2)C2CCC(O)CC2)c1 |
| InChI | InChI=1S/C20H29NO4/c22-17-6-4-16(5-7-17)21(11-15-2-1-3-18(23)10-15)12-19-8-9-20(25-19)13-24-14-20/h1-3,10,16-17,19,22-23H,4-9,11-14H2 |
| InChIKey | DNDKMAGVLJITAX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol?
The IUPAC name of 3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol (CID 167980448) is 3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol.
What is the SMILES notation for 3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol?
The canonical SMILES for 3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol is Oc1cccc(CN(CC2CCC3(COC3)O2)C2CCC(O)CC2)c1.
What is the InChIKey of 3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol?
The InChIKey is DNDKMAGVLJITAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO4/c22-17-6-4-16(5-7-17)21(11-15-2-1-3-18(23)10-15)12-19-8-9-20(25-19)13-24-14-20/h1-3,10,16-17,19,22-23H,4-9,11-14H2.
What are the key properties of 3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol?
3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol has a molecular weight of 347.45 g/mol, XLogP of 2.45, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,5-dioxaspiro[3.4]octan-6-ylmethyl-(4-hydroxycyclohexyl)amino]methyl]phenol is sourced from PubChem (CID 167980448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).