C19H14F2N4OS2 — CID 167980781
5,7-difluoro-N-(7-methyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 167980781) has the molecular formula C19H14F2N4OS2 and a molecular weight of 416.48 g/mol. Its IUPAC name is 5,7-difluoro-N-(7-methyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | 5,7-difluoro-N-(7-methyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 167980781 |
| Molecular Formula | C19H14F2N4OS2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 5,7-difluoro-N-(7-methyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | Cc1nc2ccc3nc(NC(=O)N4CCc5c(F)cc(F)cc5C4)sc3c2s1 |
| InChI | InChI=1S/C19H14F2N4OS2/c1-9-22-14-2-3-15-17(16(14)27-9)28-18(23-15)24-19(26)25-5-4-12-10(8-25)6-11(20)7-13(12)21/h2-3,6-7H,4-5,8H2,1H3,(H,23,24,26) |
| InChIKey | XXQXJQVEBQSMJG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |