C22H23N5O2 — CID 167981430
1-[5-[4-(5-methoxy-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]pyrazin-2-yl]pyrrolidin-2-one (PubChem CID 167981430) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-[5-[4-(5-methoxy-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]pyrazin-2-yl]pyrrolidin-2-one.
| Compound Name | 1-[5-[4-(5-methoxy-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]pyrazin-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 167981430 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-[5-[4-(5-methoxy-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]pyrazin-2-yl]pyrrolidin-2-one |
| SMILES | COc1ccc2[nH]cc(C3=CCN(c4cnc(N5CCCC5=O)cn4)CC3)c2c1 |
| InChI | InChI=1S/C22H23N5O2/c1-29-16-4-5-19-17(11-16)18(12-23-19)15-6-9-26(10-7-15)20-13-25-21(14-24-20)27-8-2-3-22(27)28/h4-6,11-14,23H,2-3,7-10H2,1H3 |
| InChIKey | YTIIQUBNQUKRPD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|