About methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate
methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate (PubChem CID 167982177) has the molecular formula C14H15N3O4
and a molecular weight of 289.29 g/mol. Its IUPAC name is methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate.
Molecular Properties
| Compound Name | methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate |
| PubChem CID | 167982177 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2cn([C@@H]3COC[C@H]3O)nn2)c1 |
| InChI | InChI=1S/C14H15N3O4/c1-20-14(19)10-4-2-3-9(5-10)11-6-17(16-15-11)12-7-21-8-13(12)18/h2-6,12-13,18H,7-8H2,1H3/t12-,13-/m1/s1 |
| InChIKey | BPHMGQPJXPWFIN-CHWSQXEVSA-N |
| XLogP | 0.66 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate?
The IUPAC name of methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate (CID 167982177) is methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate.
What is the SMILES notation for methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate?
The canonical SMILES for methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate is COC(=O)c1cccc(-c2cn([C@@H]3COC[C@H]3O)nn2)c1.
What is the InChIKey of methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate?
The InChIKey is BPHMGQPJXPWFIN-CHWSQXEVSA-N. The full InChI is InChI=1S/C14H15N3O4/c1-20-14(19)10-4-2-3-9(5-10)11-6-17(16-15-11)12-7-21-8-13(12)18/h2-6,12-13,18H,7-8H2,1H3/t12-,13-/m1/s1.
What are the key properties of methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate?
methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate has a molecular weight of 289.29 g/mol, XLogP of 0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazol-4-yl]benzoate is sourced from PubChem (CID 167982177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).