C14H21F3N4O — CID 167982639
5,5-dimethyl-N-[[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]oxolan-3-amine (PubChem CID 167982639) has the molecular formula C14H21F3N4O and a molecular weight of 318.34 g/mol. Its IUPAC name is 5,5-dimethyl-N-[[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]oxolan-3-amine.
| Compound Name | 5,5-dimethyl-N-[[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 167982639 |
| Molecular Formula | C14H21F3N4O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 5,5-dimethyl-N-[[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]oxolan-3-amine |
| SMILES | CC1(C)CC(NCc2nnc3n2CCCC3C(F)(F)F)CO1 |
| InChI | InChI=1S/C14H21F3N4O/c1-13(2)6-9(8-22-13)18-7-11-19-20-12-10(14(15,16)17)4-3-5-21(11)12/h9-10,18H,3-8H2,1-2H3 |
| InChIKey | ICBOGJIWUQGZSW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |