C18H20F2N2O3 — CID 167982957
2-[4-(2,4-difluorophenyl)oxan-4-yl]-5-(oxan-3-yl)-1,3,4-oxadiazole (PubChem CID 167982957) has the molecular formula C18H20F2N2O3 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[4-(2,4-difluorophenyl)oxan-4-yl]-5-(oxan-3-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[4-(2,4-difluorophenyl)oxan-4-yl]-5-(oxan-3-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 167982957 |
| Molecular Formula | C18H20F2N2O3 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[4-(2,4-difluorophenyl)oxan-4-yl]-5-(oxan-3-yl)-1,3,4-oxadiazole |
| SMILES | Fc1ccc(C2(c3nnc(C4CCCOC4)o3)CCOCC2)c(F)c1 |
| InChI | InChI=1S/C18H20F2N2O3/c19-13-3-4-14(15(20)10-13)18(5-8-23-9-6-18)17-22-21-16(25-17)12-2-1-7-24-11-12/h3-4,10,12H,1-2,5-9,11H2 |
| InChIKey | YQYZCWYAFFNTRQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |