C16H23F4N5O4 — CID 167983038
[(2S,4R)-1-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]-4-fluoropyrrolidin-2-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 167983038) has the molecular formula C16H23F4N5O4 and a molecular weight of 425.38 g/mol. Its IUPAC name is [(2S,4R)-1-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]-4-fluoropyrrolidin-2-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(2S,4R)-1-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]-4-fluoropyrrolidin-2-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167983038 |
| Molecular Formula | C16H23F4N5O4 |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [(2S,4R)-1-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]-4-fluoropyrrolidin-2-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | CCc1n[nH]c(CN2C[C@H](F)C[C@H]2C(=O)N2CCOCC2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22FN5O2.C2HF3O2/c1-2-12-16-13(18-17-12)9-20-8-10(15)7-11(20)14(21)19-3-5-22-6-4-19;3-2(4,5)1(6)7/h10-11H,2-9H2,1H3,(H,16,17,18);(H,6,7)/t10-,11+;/m1./s1 |
| InChIKey | HDTRAVXTYXFGSH-DHXVBOOMSA-N |
| XLogP | 0.77 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |