C23H28N4O2 — CID 167983630
2-oxo-2-(4-prop-2-enyl-1,4-diazepan-1-yl)-N-[1-(4-pyridin-4-ylphenyl)ethyl]acetamide (PubChem CID 167983630) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-oxo-2-(4-prop-2-enyl-1,4-diazepan-1-yl)-N-[1-(4-pyridin-4-ylphenyl)ethyl]acetamide.
| Compound Name | 2-oxo-2-(4-prop-2-enyl-1,4-diazepan-1-yl)-N-[1-(4-pyridin-4-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 167983630 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-oxo-2-(4-prop-2-enyl-1,4-diazepan-1-yl)-N-[1-(4-pyridin-4-ylphenyl)ethyl]acetamide |
| SMILES | C=CCN1CCCN(C(=O)C(=O)NC(C)c2ccc(-c3ccncc3)cc2)CC1 |
| InChI | InChI=1S/C23H28N4O2/c1-3-13-26-14-4-15-27(17-16-26)23(29)22(28)25-18(2)19-5-7-20(8-6-19)21-9-11-24-12-10-21/h3,5-12,18H,1,4,13-17H2,2H3,(H,25,28) |
| InChIKey | APGAORVUFRWIGE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|