About N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide
N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide (PubChem CID 16798364) has the molecular formula C23H19FN2O2S
and a molecular weight of 406.48 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide |
| PubChem CID | 16798364 |
| Molecular Formula | C23H19FN2O2S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide |
| SMILES | O=C(CN1C(=O)CC(c2ccccc2)Sc2ccccc21)Nc1ccccc1F |
| InChI | InChI=1S/C23H19FN2O2S/c24-17-10-4-5-11-18(17)25-22(27)15-26-19-12-6-7-13-20(19)29-21(14-23(26)28)16-8-2-1-3-9-16/h1-13,21H,14-15H2,(H,25,27) |
| InChIKey | GEINWNDNDRNSFQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide?
The IUPAC name of N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide (CID 16798364) is N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide.
What is the SMILES notation for N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide?
The canonical SMILES for N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide is O=C(CN1C(=O)CC(c2ccccc2)Sc2ccccc21)Nc1ccccc1F.
What is the InChIKey of N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide?
The InChIKey is GEINWNDNDRNSFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19FN2O2S/c24-17-10-4-5-11-18(17)25-22(27)15-26-19-12-6-7-13-20(19)29-21(14-23(26)28)16-8-2-1-3-9-16/h1-13,21H,14-15H2,(H,25,27).
What are the key properties of N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide?
N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide has a molecular weight of 406.48 g/mol, XLogP of 5.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorophenyl)-2-(4-oxo-2-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide is sourced from PubChem (CID 16798364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).